881-07-2 8-Nitroquinaldine
| produktnavn |
8-Nitroquinaldine |
| Engelsk navn |
8-Nitroquinaldine; Nitroquinaldine; 2-Methyl-8-nitroquinoline |
| Molekyl?r Formel |
C10H8N2O2 |
| Molekylvekt |
188.1827 |
| InChI |
InChI=1/C10H8N2O2/c1-7-5-6-8-3-2-4-9(12(13)14)10(8)11-7/h2-6H,1H3 |
| CAS-nummer |
881-07-2 |
| EINECS |
212-919-6 |
| Molecular Structure |
|
| Tetthet |
1.298g/cm3 |
| Kokepunkt |
323.8°C at 760 mmHg |
| Brytningsindeks |
1.661 |
| Flammepunktet |
149.6°C |
| Damptrykk |
0.000483mmHg at 25°C |
| Risiko Koder |
R40:Possible risks of irreversible effects.;
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|