881-07-2 8-Nitroquinaldine
| termék neve |
8-Nitroquinaldine |
| Angol név |
8-Nitroquinaldine; Nitroquinaldine; 2-Methyl-8-nitroquinoline |
| MF |
C10H8N2O2 |
| Molekulat?meg |
188.1827 |
| InChI |
InChI=1/C10H8N2O2/c1-7-5-6-8-3-2-4-9(12(13)14)10(8)11-7/h2-6H,1H3 |
| CAS-szám |
881-07-2 |
| EINECS |
212-919-6 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.298g/cm3 |
| Forráspont |
323.8°C at 760 mmHg |
| T?résmutató |
1.661 |
| Gyulladáspont |
149.6°C |
| G?znyomás |
0.000483mmHg at 25°C |
| Kockázatot kódok |
R40:Possible risks of irreversible effects.;
|
| Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|