881-07-2 8-Nitroquinaldine
| Nome del prodotto |
8-Nitroquinaldine |
| Nome inglese |
8-Nitroquinaldine; Nitroquinaldine; 2-Methyl-8-nitroquinoline |
| Formula molecolare |
C10H8N2O2 |
| Peso Molecolare |
188.1827 |
| InChI |
InChI=1/C10H8N2O2/c1-7-5-6-8-3-2-4-9(12(13)14)10(8)11-7/h2-6H,1H3 |
| Numero CAS |
881-07-2 |
| EINECS |
212-919-6 |
| Struttura molecolare |
|
| Densità |
1.298g/cm3 |
| Punto di ebollizione |
323.8°C at 760 mmHg |
| Indice di rifrazione |
1.661 |
| Punto d'infiammabilità |
149.6°C |
| Pressione di vapore |
0.000483mmHg at 25°C |
| Codici di Rischio |
R40:Possible risks of irreversible effects.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|