598-52-7 N-Methylthiourea
| produktnavn |
N-Methylthiourea |
| Engelsk navn |
N-Methylthiourea; N-Methyl thiourea; 1-methylthiourea |
| Molekyl?r Formel |
C2H6N2S |
| Molekylvekt |
90.1474 |
| InChI |
InChI=1/C2H6N2S/c1-4-2(3)5/h1H3,(H3,3,4,5) |
| CAS-nummer |
598-52-7 |
| EINECS |
209-936-6 |
| Molecular Structure |
|
| Tetthet |
1.14g/cm3 |
| Smeltepunkt |
118-123℃ |
| Kokepunkt |
141.1°C at 760 mmHg |
| Brytningsindeks |
1.564 |
| Flammepunktet |
39.1°C |
| Damptrykk |
5.95mmHg at 25°C |
| Hazard symboler |
T:Toxic;
|
| Risiko Koder |
R25:Toxic if swallowed.;
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|