598-52-7 N-Methylthiourea
| Produkt-Name |
N-Methylthiourea |
| Englischer Name |
N-Methylthiourea; N-Methyl thiourea; 1-methylthiourea |
| Molekulare Formel |
C2H6N2S |
| Molecular Weight |
90.1474 |
| InChI |
InChI=1/C2H6N2S/c1-4-2(3)5/h1H3,(H3,3,4,5) |
| CAS Registry Number |
598-52-7 |
| EINECS |
209-936-6 |
| Molecular Structure |
|
| Dichte |
1.14g/cm3 |
| Schmelzpunkt |
118-123℃ |
| Siedepunkt |
141.1°C at 760 mmHg |
| Brechungsindex |
1.564 |
| Flammpunkt |
39.1°C |
| Dampfdruck |
5.95mmHg at 25°C |
| Gefahrensymbole |
T:Toxic;
|
| Risk Codes |
R25:Toxic if swallowed.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|