598-52-7 N-Methylthiourea
| Naam product |
N-Methylthiourea |
| Engelse naam |
N-Methylthiourea; N-Methyl thiourea; 1-methylthiourea |
| MF |
C2H6N2S |
| Molecuulgewicht |
90.1474 |
| InChI |
InChI=1/C2H6N2S/c1-4-2(3)5/h1H3,(H3,3,4,5) |
| CAS-nummer |
598-52-7 |
| EINECS |
209-936-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.14g/cm3 |
| Smeltpunt |
118-123℃ |
| Kookpunt |
141.1°C at 760 mmHg |
| Brekingsindex |
1.564 |
| Vlampunt |
39.1°C |
| Dampdruk |
5.95mmHg at 25°C |
| Gevaarsymbolen |
T:Toxic;
|
| Risico-codes |
R25:Toxic if swallowed.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|