565-67-3 2-Methyl-3-pentanol
| produktnavn |
2-Methyl-3-pentanol |
| Engelsk navn |
2-Methyl-3-pentanol; Ethyl isopropyl carbinol; 2-methylpentan-3-ol; (3S)-2-methylpentan-3-ol; (3R)-2-methylpentan-3-ol |
| Molekyl?r Formel |
C6H14O |
| Molekylvekt |
102.1748 |
| InChI |
InChI=1/C6H14O/c1-4-6(7)5(2)3/h5-7H,4H2,1-3H3/t6-/m1/s1 |
| CAS-nummer |
565-67-3 |
| EINECS |
209-286-3 |
| Molecular Structure |
|
| Tetthet |
0.811g/cm3 |
| Kokepunkt |
126.5°C at 760 mmHg |
| Brytningsindeks |
1.411 |
| Flammepunktet |
46.1°C |
| Damptrykk |
5.35mmHg at 25°C |
| Hazard symboler |
Xi:Irritant;
|
| Risiko Koder |
R10:Flammable.;
R37:Irritating to respiratory system.;
|
| Sikkerhet Beskrivelse |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
|