565-67-3 2-Methyl-3-pentanol
| Nama produk |
2-Methyl-3-pentanol |
| Nama bahasa Inggris |
2-Methyl-3-pentanol; Ethyl isopropyl carbinol; 2-methylpentan-3-ol; (3S)-2-methylpentan-3-ol; (3R)-2-methylpentan-3-ol |
| MF |
C6H14O |
| Berat Molekul |
102.1748 |
| InChI |
InChI=1/C6H14O/c1-4-6(7)5(2)3/h5-7H,4H2,1-3H3/t6-/m1/s1 |
| CAS NO |
565-67-3 |
| EINECS |
209-286-3 |
| Struktur Molekul |
|
| Kepadatan |
0.811g/cm3 |
| Titik didih |
126.5°C at 760 mmHg |
| Indeks bias |
1.411 |
| Titik nyala |
46.1°C |
| Tekanan uap |
5.35mmHg at 25°C |
| Simbol bahaya |
Xi:Irritant;
|
| Kode Risiko |
R10:Flammable.;
R37:Irritating to respiratory system.;
|
| Keselamatan Deskripsi |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
|