565-67-3 2-Methyl-3-pentanol
| product Name |
2-Methyl-3-pentanol |
| CAS No |
565-67-3 |
| Synonyms |
Ethyl isopropyl carbinol; 2-methylpentan-3-ol; (3S)-2-methylpentan-3-ol; (3R)-2-methylpentan-3-ol |
| Molecular Formula |
C6H14O |
| Molecular Weight |
102.1748 |
| InChI |
InChI=1/C6H14O/c1-4-6(7)5(2)3/h5-7H,4H2,1-3H3/t6-/m1/s1 |
| EINECS |
209-286-3 |
| Molecular Structure |
|
| Density |
0.811g/cm3 |
| Boiling point |
126.5°C at 760 mmHg |
| Refractive index |
1.411 |
| Flash point |
46.1°C |
| Vapour Pressur |
5.35mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R10:Flammable.;
R37:Irritating to respiratory system.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
|