88-97-1 phthalamic acid
| Naam product |
phthalamic acid |
| Engelse naam |
phthalamic acid; Phthalamic acid, (2-Carboxybenzamide); 2-Carboxybenzamide; 2-carbamoylbenzoic acid |
| MF |
C8H7NO3 |
| Molecuulgewicht |
165.1461 |
| InChI |
InChI=1/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
| CAS-nummer |
88-97-1 |
| EINECS |
201-871-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.368g/cm3 |
| Kookpunt |
394.2°C at 760 mmHg |
| Brekingsindex |
1.615 |
| Vlampunt |
192.2°C |
| Dampdruk |
6.38E-07mmHg at 25°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|