88-97-1 phthalamic acid
| ?????? ?? ??? |
phthalamic acid |
| ???????? ??? |
phthalamic acid; Phthalamic acid, (2-Carboxybenzamide); 2-Carboxybenzamide; 2-carbamoylbenzoic acid |
| ????? ???????? |
C8H7NO3 |
| ?????? ??? |
165.1461 |
| InChI |
InChI=1/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
| ??? ??????? ?????? |
88-97-1 |
| EINECS |
201-871-1 |
| ????? ?????? |
|
| ????? |
1.368g/cm3 |
| ????? ?? ??? |
394.2°C at 760 mmHg |
| ??????? ??????? |
1.615 |
| ????? ??????? |
192.2°C |
| ????? ?? ???? |
6.38E-07mmHg at 25°C |
| ???? ?? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|