88-97-1 phthalamic acid
| termék neve |
phthalamic acid |
| Angol név |
phthalamic acid; Phthalamic acid, (2-Carboxybenzamide); 2-Carboxybenzamide; 2-carbamoylbenzoic acid |
| MF |
C8H7NO3 |
| Molekulat?meg |
165.1461 |
| InChI |
InChI=1/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
| CAS-szám |
88-97-1 |
| EINECS |
201-871-1 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.368g/cm3 |
| Forráspont |
394.2°C at 760 mmHg |
| T?résmutató |
1.615 |
| Gyulladáspont |
192.2°C |
| G?znyomás |
6.38E-07mmHg at 25°C |
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|