711-79-5 2-Acetyl-1-naphthol
| Naam product |
2-Acetyl-1-naphthol |
| Engelse naam |
2-Acetyl-1-naphthol; 1-Hydroxy-2-acetonaphthone; 2-Acetyl-1-hydroxynaphthalene |
| MF |
C12H10O2 |
| Molecuulgewicht |
186.2066 |
| InChI |
InChI=1/C12H10O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,14H,1H3 |
| CAS-nummer |
711-79-5 |
| EINECS |
211-918-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.213g/cm3 |
| Smeltpunt |
97-100℃ |
| Kookpunt |
334.9°C at 760 mmHg |
| Brekingsindex |
1.65 |
| Vlampunt |
142.4°C |
| Dampdruk |
6.37E-05mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|