711-79-5 2-Acetyl-1-naphthol
| Produkt-Name |
2-Acetyl-1-naphthol |
| Englischer Name |
2-Acetyl-1-naphthol; 1-Hydroxy-2-acetonaphthone; 2-Acetyl-1-hydroxynaphthalene |
| Molekulare Formel |
C12H10O2 |
| Molecular Weight |
186.2066 |
| InChI |
InChI=1/C12H10O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,14H,1H3 |
| CAS Registry Number |
711-79-5 |
| EINECS |
211-918-8 |
| Molecular Structure |
|
| Dichte |
1.213g/cm3 |
| Schmelzpunkt |
97-100℃ |
| Siedepunkt |
334.9°C at 760 mmHg |
| Brechungsindex |
1.65 |
| Flammpunkt |
142.4°C |
| Dampfdruck |
6.37E-05mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|