711-79-5 2-Acetyl-1-naphthol
| Nama produk |
2-Acetyl-1-naphthol |
| Nama bahasa Inggris |
2-Acetyl-1-naphthol; 1-Hydroxy-2-acetonaphthone; 2-Acetyl-1-hydroxynaphthalene |
| MF |
C12H10O2 |
| Berat Molekul |
186.2066 |
| InChI |
InChI=1/C12H10O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,14H,1H3 |
| CAS NO |
711-79-5 |
| EINECS |
211-918-8 |
| Struktur Molekul |
|
| Kepadatan |
1.213g/cm3 |
| Titik lebur |
97-100℃ |
| Titik didih |
334.9°C at 760 mmHg |
| Indeks bias |
1.65 |
| Titik nyala |
142.4°C |
| Tekanan uap |
6.37E-05mmHg at 25°C |
| Simbol bahaya |
Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|