624-16-8 4-Decanone
| Naam product |
4-Decanone |
| Engelse naam |
4-Decanone; n-Hexyl n-propyl ketone; Decanone; decan-1-oyl chloride; decan-4-one |
| MF |
C10H20O |
| Molecuulgewicht |
156.2652 |
| InChI |
InChI=1/C10H20O/c1-3-5-6-7-9-10(11)8-4-2/h3-9H2,1-2H3 |
| CAS-nummer |
624-16-8 |
| EINECS |
210-832-8 |
| Moleculaire Structuur |
|
| Dichtheid |
0.819g/cm3 |
| Smeltpunt |
-9℃ |
| Kookpunt |
208.7°C at 760 mmHg |
| Brekingsindex |
1.421 |
| Vlampunt |
71.1°C |
| Dampdruk |
0.211mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|