624-16-8 4-Decanone
| Nome del prodotto |
4-Decanone |
| Nome inglese |
4-Decanone; n-Hexyl n-propyl ketone; Decanone; decan-1-oyl chloride; decan-4-one |
| Formula molecolare |
C10H20O |
| Peso Molecolare |
156.2652 |
| InChI |
InChI=1/C10H20O/c1-3-5-6-7-9-10(11)8-4-2/h3-9H2,1-2H3 |
| Numero CAS |
624-16-8 |
| EINECS |
210-832-8 |
| Struttura molecolare |
|
| Densità |
0.819g/cm3 |
| Punto di fusione |
-9℃ |
| Punto di ebollizione |
208.7°C at 760 mmHg |
| Indice di rifrazione |
1.421 |
| Punto d'infiammabilità |
71.1°C |
| Pressione di vapore |
0.211mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|