624-16-8 4-Decanone
| Produkt-Name |
4-Decanone |
| Englischer Name |
4-Decanone; n-Hexyl n-propyl ketone; Decanone; decan-1-oyl chloride; decan-4-one |
| Molekulare Formel |
C10H20O |
| Molecular Weight |
156.2652 |
| InChI |
InChI=1/C10H20O/c1-3-5-6-7-9-10(11)8-4-2/h3-9H2,1-2H3 |
| CAS Registry Number |
624-16-8 |
| EINECS |
210-832-8 |
| Molecular Structure |
|
| Dichte |
0.819g/cm3 |
| Schmelzpunkt |
-9℃ |
| Siedepunkt |
208.7°C at 760 mmHg |
| Brechungsindex |
1.421 |
| Flammpunkt |
71.1°C |
| Dampfdruck |
0.211mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|