601-79-6 Isopropylmalonic acid
| Naam product |
Isopropylmalonic acid |
| Engelse naam |
Isopropylmalonic acid; isopropyl malonic acid; propan-2-ylpropanedioic acid; (1-methylethyl)propanedioate |
| MF |
C6H8O4 |
| Molecuulgewicht |
144.1264 |
| InChI |
InChI=1/C6H10O4/c1-3(2)4(5(7)8)6(9)10/h3-4H,1-2H3,(H,7,8)(H,9,10)/p-2 |
| CAS-nummer |
601-79-6 |
| EINECS |
210-008-8 |
| Moleculaire Structuur |
|
| Kookpunt |
315.4°C at 760 mmHg |
| Vlampunt |
158.7°C |
| Dampdruk |
9.44E-05mmHg at 25°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|