601-79-6 Isopropylmalonic acid
| product Name |
Isopropylmalonic acid |
| CAS No |
601-79-6 |
| Synonyms |
isopropyl malonic acid; propan-2-ylpropanedioic acid; (1-methylethyl)propanedioate |
| Molecular Formula |
C6H8O4 |
| Molecular Weight |
144.1264 |
| InChI |
InChI=1/C6H10O4/c1-3(2)4(5(7)8)6(9)10/h3-4H,1-2H3,(H,7,8)(H,9,10)/p-2 |
| EINECS |
210-008-8 |
| Molecular Structure |
|
| Boiling point |
315.4°C at 760 mmHg |
| Flash point |
158.7°C |
| Vapour Pressur |
9.44E-05mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Contact |
Manager Zhang |
| Telephone |
13801051730 |
| Email |
sales@soarchem.com |
| Address |
D3, Fourth Floor, No. 11-1 Tonghu Street, Tongzhou District, Beijing |