601-79-6 Isopropylmalonic acid
| Nom |
Isopropylmalonic acid |
| Nom anglais |
Isopropylmalonic acid; isopropyl malonic acid; propan-2-ylpropanedioic acid; (1-methylethyl)propanedioate |
| Formule moléculaire |
C6H8O4 |
| Poids Moléculaire |
144.1264 |
| InChI |
InChI=1/C6H10O4/c1-3(2)4(5(7)8)6(9)10/h3-4H,1-2H3,(H,7,8)(H,9,10)/p-2 |
| Numéro de registre CAS |
601-79-6 |
| EINECS |
210-008-8 |
| Structure moléculaire |
|
| Point d'ébullition |
315.4°C at 760 mmHg |
| Point d'éclair |
158.7°C |
| Pression de vapeur |
9.44E-05mmHg at 25°C |
| Codes des risques |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Description de sécurité |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|