ChemNet > CAS > 4920-80-3 3-Methoxy-2-nitrobenzoic acid
4920-80-3 3-Methoxy-2-nitrobenzoic acid
| Naam product |
3-Methoxy-2-nitrobenzoic acid |
| Engelse naam |
3-Methoxy-2-nitrobenzoic acid; 2-Nitro-m-anisic acid; 3-methoxy-2-nitrobenzoate; 2-NITRO-3-METHOXYBENZOIC ACID |
| MF |
C8H6NO5 |
| Molecuulgewicht |
196.1375 |
| InChI |
InChI=1/C8H7NO5/c1-14-6-4-2-3-5(8(10)11)7(6)9(12)13/h2-4H,1H3,(H,10,11)/p-1 |
| CAS-nummer |
4920-80-3 |
| EINECS |
225-549-5 |
| Moleculaire Structuur |
|
| Smeltpunt |
253-258℃ |
| Kookpunt |
388.2°C at 760 mmHg |
| Vlampunt |
188.6°C |
| Dampdruk |
1.01E-06mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|