ChemNet > CAS > 4920-80-3 3-Methoxy-2-nitrobenzoic acid
4920-80-3 3-Methoxy-2-nitrobenzoic acid
| Nome del prodotto |
3-Methoxy-2-nitrobenzoic acid |
| Nome inglese |
3-Methoxy-2-nitrobenzoic acid; 2-Nitro-m-anisic acid; 3-methoxy-2-nitrobenzoate; 2-NITRO-3-METHOXYBENZOIC ACID |
| Formula molecolare |
C8H6NO5 |
| Peso Molecolare |
196.1375 |
| InChI |
InChI=1/C8H7NO5/c1-14-6-4-2-3-5(8(10)11)7(6)9(12)13/h2-4H,1H3,(H,10,11)/p-1 |
| Numero CAS |
4920-80-3 |
| EINECS |
225-549-5 |
| Struttura molecolare |
|
| Punto di fusione |
253-258℃ |
| Punto di ebollizione |
388.2°C at 760 mmHg |
| Punto d'infiammabilità |
188.6°C |
| Pressione di vapore |
1.01E-06mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|