ChemNet > CAS > 4920-80-3 3-Methoxy-2-nitrobenzoic acid
4920-80-3 3-Methoxy-2-nitrobenzoic acid
| termék neve |
3-Methoxy-2-nitrobenzoic acid |
| Angol név |
3-Methoxy-2-nitrobenzoic acid; 2-Nitro-m-anisic acid; 3-methoxy-2-nitrobenzoate; 2-NITRO-3-METHOXYBENZOIC ACID |
| MF |
C8H6NO5 |
| Molekulat?meg |
196.1375 |
| InChI |
InChI=1/C8H7NO5/c1-14-6-4-2-3-5(8(10)11)7(6)9(12)13/h2-4H,1H3,(H,10,11)/p-1 |
| CAS-szám |
4920-80-3 |
| EINECS |
225-549-5 |
| Molekuláris szerkezete |
|
| Olvadáspont |
253-258℃ |
| Forráspont |
388.2°C at 760 mmHg |
| Gyulladáspont |
188.6°C |
| G?znyomás |
1.01E-06mmHg at 25°C |
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|