ChemNet > CAS > 35450-36-3 Methyl 2-bromo-5-methoxybenzoate
35450-36-3 Methyl 2-bromo-5-methoxybenzoate
| Naam product |
Methyl 2-bromo-5-methoxybenzoate |
| Engelse naam |
Methyl 2-bromo-5-methoxybenzoate; 2-Bromo-5-methoxybenzoic acid methyl ester |
| MF |
C9H9BrO3 |
| Molecuulgewicht |
245.07 |
| InChI |
InChI=1/C9H9BrO3/c1-12-6-3-4-8(10)7(5-6)9(11)13-2/h3-5H,1-2H3 |
| CAS-nummer |
35450-36-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.462g/cm3 |
| Kookpunt |
291.9°C at 760 mmHg |
| Brekingsindex |
1.537 |
| Vlampunt |
130.4°C |
| Dampdruk |
0.00189mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|