ChemNet > CAS > 35450-36-3 Methyl 2-bromo-5-methoxybenzoate
35450-36-3 Methyl 2-bromo-5-methoxybenzoate
| Nama produk |
Methyl 2-bromo-5-methoxybenzoate |
| Nama bahasa Inggris |
Methyl 2-bromo-5-methoxybenzoate; 2-Bromo-5-methoxybenzoic acid methyl ester |
| MF |
C9H9BrO3 |
| Berat Molekul |
245.07 |
| InChI |
InChI=1/C9H9BrO3/c1-12-6-3-4-8(10)7(5-6)9(11)13-2/h3-5H,1-2H3 |
| CAS NO |
35450-36-3 |
| Struktur Molekul |
|
| Kepadatan |
1.462g/cm3 |
| Titik didih |
291.9°C at 760 mmHg |
| Indeks bias |
1.537 |
| Titik nyala |
130.4°C |
| Tekanan uap |
0.00189mmHg at 25°C |
| Simbol bahaya |
Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|