ChemNet > CAS > 35450-36-3 Methyl 2-bromo-5-methoxybenzoate
35450-36-3 Methyl 2-bromo-5-methoxybenzoate
| termék neve |
Methyl 2-bromo-5-methoxybenzoate |
| Angol név |
Methyl 2-bromo-5-methoxybenzoate; 2-Bromo-5-methoxybenzoic acid methyl ester |
| MF |
C9H9BrO3 |
| Molekulat?meg |
245.07 |
| InChI |
InChI=1/C9H9BrO3/c1-12-6-3-4-8(10)7(5-6)9(11)13-2/h3-5H,1-2H3 |
| CAS-szám |
35450-36-3 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.462g/cm3 |
| Forráspont |
291.9°C at 760 mmHg |
| T?résmutató |
1.537 |
| Gyulladáspont |
130.4°C |
| G?znyomás |
0.00189mmHg at 25°C |
| Veszély szimbólumok |
Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|