ChemNet > CAS > 836-44-2 4-Amino-4'-hydroxystilbene
836-44-2 4-Amino-4'-hydroxystilbene
| Nama produk |
4-Amino-4'-hydroxystilbene |
| Sinonim |
4-[(E)-2-(4-aminophenyl)ethenyl]fenol; 4-[(Z)-2-(4-aminophenyl)vinil]fenol |
| Nama Inggeris |
4-Amino-4'-hydroxystilbene;4-[(E)-2-(4-aminophenyl)ethenyl]phenol; 4-[(Z)-2-(4-aminophenyl)vinyl]phenol |
| MF |
C14H13NO |
| Berat Molekul |
211.2591 |
| InChI |
InChI=1/C14H13NO/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12/h1-10,16H,15H2/b2-1- |
| CAS NO |
836-44-2 |
| Struktur Molekul |
|
| Kepadatan |
1.218g/cm3 |
| Titik didih |
412.2°C at 760 mmHg |
| Indeks bias |
1.737 |
| Titik nyala |
203.1°C |
| Tekanan wap |
2.21E-07mmHg at 25°C |
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|