ChemNet > CAS > 836-44-2 4-amino-4'-hydroxystilbeen
836-44-2 4-amino-4'-hydroxystilbeen
| Naam product |
4-amino-4'-hydroxystilbeen |
| Synoniemen |
4-[(E)-2-(4-aminofenyl)ethenyl]fenol; 4-[(Z)-2-(4-aminofenyl)vinyl]fenol |
| Engelse naam |
4-Amino-4'-hydroxystilbene;4-[(E)-2-(4-aminophenyl)ethenyl]phenol; 4-[(Z)-2-(4-aminophenyl)vinyl]phenol |
| MF |
C14H13NO |
| Molecuulgewicht |
211.2591 |
| InChI |
InChI=1/C14H13NO/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12/h1-10,16H,15H2/b2-1- |
| CAS-nummer |
836-44-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.218g/cm3 |
| Kookpunt |
412.2°C at 760 mmHg |
| Brekingsindex |
1.737 |
| Vlampunt |
203.1°C |
| Dampdruk |
2.21E-07mmHg at 25°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|