ChemNet > CAS > 836-44-2 4-?????-4'-???????????????. 4- [(E) -2- (4-??????????) ???????] ??????? ? 4-[(Z)-2- (4-??????????)?????] ????????
836-44-2 4-?????-4'-???????????????. 4- [(E) -2- (4-??????????) ???????] ??????? ? 4-[(Z)-2- (4-??????????)?????] ????????
| ??? ?????? |
4-?????-4'-???????????????. 4- [(E) -2- (4-??????????) ???????] ??????? ? 4-[(Z)-2- (4-??????????)?????] ???????? |
| ????? ??????????? |
4-Amino-4'-hydroxystilbene;4-[(E)-2-(4-aminophenyl)ethenyl]phenol; 4-[(Z)-2-(4-aminophenyl)vinyl]phenol |
| ?????? ???????? |
C14H13NO |
| ????? ??????? ??????? |
211.2591 |
| InChI |
InChI=1/C14H13NO/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12/h1-10,16H,15H2/b2-1- |
| ?????????? ???????? ??????? |
836-44-2 |
| ???? ?????? |
|
| ????? |
1.218g/cm3 |
| ???? ??????? |
412.2°C at 760 mmHg |
| ????? ???????? |
1.737 |
| ???? ?????? |
203.1°C |
| ??? ?????? |
2.21E-07mmHg at 25°C |
| ??? ????????? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|