608-28-6 2-Iodo-m-xylene
| ???? |
2-Iodo-m-xylene |
| ?? ?? |
2-Iodo-m-xylene; 2-Iodo-1,3-Dimethylbenzene |
| ??? |
C8H9I |
| ??? |
232.0615 |
| InChI |
InChI=1/C8H9I/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
| cas?? |
608-28-6 |
| EC?? |
210-158-4 |
| ?? ?? |
|
| ?? |
1.61g/cm3 |
| ??? |
227.5°C at 760 mmHg |
| ?? ?? |
1.592 |
| ??? |
98.1°C |
| ? ??? |
insoluble |
| ??? |
0.116mmHg at 25°C |
| ??? ?? |
Xi:Irritant;
|
| ??? ?? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection;
|
|