608-28-6 2-Iodo-m-xylene
| ??? ????? |
2-Iodo-m-xylene |
| ??? ??????? |
2-Iodo-m-xylene; 2-Iodo-1,3-Dimethylbenzene |
| ????? ???????? |
C8H9I |
| ??? ??????? |
232.0615 |
| InChI |
InChI=1/C8H9I/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
| ????? ?????? |
608-28-6 |
| ????? ??????? ??????? |
210-158-4 |
| ?????? ??????? |
|
| ????? |
1.61g/cm3 |
| ???? ????? |
227.5°C at 760 mmHg |
| ???? ???? |
1.592 |
| ???? ?????? |
98.1°C |
| ?????? ?? |
insoluble |
| ???? ???? |
0.116mmHg at 25°C |
| ??? ?????? |
Xi:Irritant;
|
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection;
|
|