608-28-6 2-Iodo-m-xylene
| Nama produk |
2-Iodo-m-xylene |
| Nama bahasa Inggris |
2-Iodo-m-xylene; 2-Iodo-1,3-Dimethylbenzene |
| MF |
C8H9I |
| Berat Molekul |
232.0615 |
| InChI |
InChI=1/C8H9I/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
| CAS NO |
608-28-6 |
| EINECS |
210-158-4 |
| Struktur Molekul |
|
| Kepadatan |
1.61g/cm3 |
| Titik didih |
227.5°C at 760 mmHg |
| Indeks bias |
1.592 |
| Titik nyala |
98.1°C |
| Kelarutan air |
insoluble |
| Tekanan uap |
0.116mmHg at 25°C |
| Simbol bahaya |
Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection;
|
|