704-38-1 Bis(2-thienyl) ketone
| Nome del prodotto |
Bis(2-thienyl) ketone |
| Nome inglese |
Bis(2-thienyl) ketone; Di-2-thienyl ketone; Bis(2-thienyl)ketone~Di-2-thienyl ketone; dithiophen-2-ylmethanone |
| Formula molecolare |
C9H6OS2 |
| Peso Molecolare |
194.2733 |
| InChI |
InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
| Numero CAS |
704-38-1 |
| Struttura molecolare |
|
| Densità |
1.326g/cm3 |
| Punto di fusione |
89-91℃ |
| Punto di ebollizione |
323°C at 760 mmHg |
| Indice di rifrazione |
1.64 |
| Punto d'infiammabilità |
149.1°C |
| Pressione di vapore |
0.00027mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|