704-38-1 Bis(2-thienyl) ketone
| název vyrobku |
Bis(2-thienyl) ketone |
| Anglicky název |
Bis(2-thienyl) ketone; Di-2-thienyl ketone; Bis(2-thienyl)ketone~Di-2-thienyl ketone; dithiophen-2-ylmethanone |
| Molekulární vzorec |
C9H6OS2 |
| Molekulová hmotnost |
194.2733 |
| InChI |
InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
| Registra?ní ?íslo CAS |
704-38-1 |
| Molekulární struktura |
|
| Hustota |
1.326g/cm3 |
| Bod tání |
89-91℃ |
| Bod varu |
323°C at 760 mmHg |
| Index lomu |
1.64 |
| Bod vzplanutí |
149.1°C |
| Tlak par |
0.00027mmHg at 25°C |
| Bezpe?nostní Popis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|