704-38-1 Bis(2-thienyl) ketone
| Produkt-Name |
Bis(2-thienyl) ketone |
| Englischer Name |
Bis(2-thienyl) ketone; Di-2-thienyl ketone; Bis(2-thienyl)ketone~Di-2-thienyl ketone; dithiophen-2-ylmethanone |
| Molekulare Formel |
C9H6OS2 |
| Molecular Weight |
194.2733 |
| InChI |
InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
| CAS Registry Number |
704-38-1 |
| Molecular Structure |
|
| Dichte |
1.326g/cm3 |
| Schmelzpunkt |
89-91℃ |
| Siedepunkt |
323°C at 760 mmHg |
| Brechungsindex |
1.64 |
| Flammpunkt |
149.1°C |
| Dampfdruck |
0.00027mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|