565-68-4 4-methylpentyn-3-ol
| Nome del prodotto |
4-methylpentyn-3-ol |
| Nome inglese |
4-methylpentyn-3-ol; 1-Isopropylpropargyl alcohol; 1-pentyn-3-ol, 4-methyl-; 4-Methyl-1-pentyne-3-ol; 4-Methylpent-1-yn-3-ol |
| Formula molecolare |
C6H10O |
| Peso Molecolare |
98.143 |
| InChI |
InChI=1/C6H10O/c1-4-6(7)5(2)3/h1,5-7H,2-3H3 |
| Numero CAS |
565-68-4 |
| EINECS |
209-287-9 |
| Struttura molecolare |
|
| Densità |
0.895g/cm3 |
| Punto di ebollizione |
139.3°C at 760 mmHg |
| Indice di rifrazione |
1.444 |
| Punto d'infiammabilità |
41.9°C |
| Pressione di vapore |
2.69mmHg at 25°C |
| Codici di Rischio |
R10:Flammable.;
|
| Sicurezza Descrizione |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|