565-68-4 4-methylpentyn-3-ol
| Produkt-Name |
4-methylpentyn-3-ol |
| Englischer Name |
4-methylpentyn-3-ol; 1-Isopropylpropargyl alcohol; 1-pentyn-3-ol, 4-methyl-; 4-Methyl-1-pentyne-3-ol; 4-Methylpent-1-yn-3-ol |
| Molekulare Formel |
C6H10O |
| Molecular Weight |
98.143 |
| InChI |
InChI=1/C6H10O/c1-4-6(7)5(2)3/h1,5-7H,2-3H3 |
| CAS Registry Number |
565-68-4 |
| EINECS |
209-287-9 |
| Molecular Structure |
|
| Dichte |
0.895g/cm3 |
| Siedepunkt |
139.3°C at 760 mmHg |
| Brechungsindex |
1.444 |
| Flammpunkt |
41.9°C |
| Dampfdruck |
2.69mmHg at 25°C |
| Risk Codes |
R10:Flammable.;
|
| Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|