565-68-4 4-methylpentyn-3-ol
| Nom |
4-methylpentyn-3-ol |
| Nom anglais |
4-methylpentyn-3-ol; 1-Isopropylpropargyl alcohol; 1-pentyn-3-ol, 4-methyl-; 4-Methyl-1-pentyne-3-ol; 4-Methylpent-1-yn-3-ol |
| Formule moléculaire |
C6H10O |
| Poids Moléculaire |
98.143 |
| InChI |
InChI=1/C6H10O/c1-4-6(7)5(2)3/h1,5-7H,2-3H3 |
| Numéro de registre CAS |
565-68-4 |
| EINECS |
209-287-9 |
| Structure moléculaire |
|
| Densité |
0.895g/cm3 |
| Point d'ébullition |
139.3°C at 760 mmHg |
| Indice de réfraction |
1.444 |
| Point d'éclair |
41.9°C |
| Pression de vapeur |
2.69mmHg at 25°C |
| Codes des risques |
R10:Flammable.;
|
| Description de sécurité |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|