3396-11-0 Cesium acetate
| Nome del prodotto |
Cesium acetate |
| Nome inglese |
Cesium acetate; Cesiumacetatetech; Cesiumacetatelump; Cesium acetate,(99.9% Cs); caesium acetate |
| Formula molecolare |
C2H3CsO2 |
| Peso Molecolare |
191.9495 |
| InChI |
InChI=1/C2H4O2.Cs/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| Numero CAS |
3396-11-0 |
| EINECS |
222-248-0 |
| Struttura molecolare |
|
| Punto di fusione |
194-195℃ |
| Punto di ebollizione |
117.1°C at 760 mmHg |
| Punto d'infiammabilità |
40°C |
| Pressione di vapore |
13.9mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|