3396-11-0 Cesium acetate
| Produkt-Name |
Cesium acetate |
| Englischer Name |
Cesium acetate; Cesiumacetatetech; Cesiumacetatelump; Cesium acetate,(99.9% Cs); caesium acetate |
| Molekulare Formel |
C2H3CsO2 |
| Molecular Weight |
191.9495 |
| InChI |
InChI=1/C2H4O2.Cs/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| CAS Registry Number |
3396-11-0 |
| EINECS |
222-248-0 |
| Molecular Structure |
|
| Schmelzpunkt |
194-195℃ |
| Siedepunkt |
117.1°C at 760 mmHg |
| Flammpunkt |
40°C |
| Dampfdruck |
13.9mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|