3396-11-0 Cesium acetate
| product Name |
Cesium acetate |
| CAS No |
3396-11-0 |
| Synonyms |
Cesiumacetatetech; Cesiumacetatelump; Cesium acetate,(99.9% Cs); caesium acetate |
| Molecular Formula |
C2H3CsO2 |
| Molecular Weight |
191.9495 |
| InChI |
InChI=1/C2H4O2.Cs/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| EINECS |
222-248-0 |
| Molecular Structure |
|
| Melting point |
194-195℃ |
| Boiling point |
117.1°C at 760 mmHg |
| Flash point |
40°C |
| Vapour Pressur |
13.9mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Frank Fu |
| Telephone |
+86-790-6411121 |
| Email |
gfsale@ganfenglithium.com |
| Address |
608# Nanyuanlu, Xinyu High-Tech Industries Development Zone, Jiangxi. China. |
| Contact |
Mrs Christina Bao |
| Telephone |
+86-571-88025872 |
| Email |
sales@hzoceanchem.com |
| Address |
Room 902,ZEC Development Building, No. 258 Baishi Road, Gongshu District,Hangzhou, Zhejiang,China |