2553-04-0 2-Methoxybenzophenone
| Nome del prodotto |
2-Methoxybenzophenone |
| Nome inglese |
2-Methoxybenzophenone;(2-methoxyphenyl)(phenyl)methanone |
| Formula molecolare |
C14H12O2 |
| Peso Molecolare |
212.2439 |
| InChI |
InChI=1/C14H12O2/c1-16-13-10-6-5-9-12(13)14(15)11-7-3-2-4-8-11/h2-10H,1H3 |
| Numero CAS |
2553-04-0 |
| EINECS |
219-857-9 |
| Struttura molecolare |
|
| Densità |
1.108g/cm3 |
| Punto di ebollizione |
368.7°C at 760 mmHg |
| Indice di rifrazione |
1.568 |
| Punto d'infiammabilità |
171.7°C |
| Pressione di vapore |
1.25E-05mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|