2553-04-0 2-Methoxybenzophenone
| Nom |
2-Methoxybenzophenone |
| Nom anglais |
2-Methoxybenzophenone;(2-methoxyphenyl)(phenyl)methanone |
| Formule moléculaire |
C14H12O2 |
| Poids Moléculaire |
212.2439 |
| InChI |
InChI=1/C14H12O2/c1-16-13-10-6-5-9-12(13)14(15)11-7-3-2-4-8-11/h2-10H,1H3 |
| Numéro de registre CAS |
2553-04-0 |
| EINECS |
219-857-9 |
| Structure moléculaire |
|
| Densité |
1.108g/cm3 |
| Point d'ébullition |
368.7°C at 760 mmHg |
| Indice de réfraction |
1.568 |
| Point d'éclair |
171.7°C |
| Pression de vapeur |
1.25E-05mmHg at 25°C |
| Description de sécurité |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|