2553-04-0 2-Methoxybenzophenone
| product Name |
2-Methoxybenzophenone |
| CAS No |
2553-04-0 |
| Synonyms |
(2-methoxyphenyl)(phenyl)methanone |
| Molecular Formula |
C14H12O2 |
| Molecular Weight |
212.2439 |
| InChI |
InChI=1/C14H12O2/c1-16-13-10-6-5-9-12(13)14(15)11-7-3-2-4-8-11/h2-10H,1H3 |
| EINECS |
219-857-9 |
| Molecular Structure |
|
| Density |
1.108g/cm3 |
| Boiling point |
368.7°C at 760 mmHg |
| Refractive index |
1.568 |
| Flash point |
171.7°C |
| Vapour Pressur |
1.25E-05mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|