ChemNet > CAS > 22409-91-2 ethyl 3-phenoxypropionate
22409-91-2 ethyl 3-phenoxypropionate
| Nome del prodotto |
ethyl 3-phenoxypropionate |
| Nome inglese |
ethyl 3-phenoxypropionate; 3-Phenoxypropionic acid ethyl ester; ethyl 3-phenoxypropanoate |
| Formula molecolare |
C11H14O3 |
| Peso Molecolare |
194.2271 |
| InChI |
InChI=1/C11H14O3/c1-2-13-11(12)8-9-14-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| Numero CAS |
22409-91-2 |
| Struttura molecolare |
|
| Densità |
1.061g/cm3 |
| Punto di fusione |
22-24℃ |
| Punto di ebollizione |
287.6°C at 760 mmHg |
| Indice di rifrazione |
1.493 |
| Punto d'infiammabilità |
116°C |
| Pressione di vapore |
0.00246mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|