ChemNet > CAS > 22409-91-2 ethyl 3-phenoxypropionate
22409-91-2 ethyl 3-phenoxypropionate
| Produkt-Name |
ethyl 3-phenoxypropionate |
| Englischer Name |
ethyl 3-phenoxypropionate; 3-Phenoxypropionic acid ethyl ester; ethyl 3-phenoxypropanoate |
| Molekulare Formel |
C11H14O3 |
| Molecular Weight |
194.2271 |
| InChI |
InChI=1/C11H14O3/c1-2-13-11(12)8-9-14-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| CAS Registry Number |
22409-91-2 |
| Molecular Structure |
|
| Dichte |
1.061g/cm3 |
| Schmelzpunkt |
22-24℃ |
| Siedepunkt |
287.6°C at 760 mmHg |
| Brechungsindex |
1.493 |
| Flammpunkt |
116°C |
| Dampfdruck |
0.00246mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|