ChemNet > CAS > 22409-91-2 ethyl 3-phenoxypropionate
22409-91-2 ethyl 3-phenoxypropionate
| product Name |
ethyl 3-phenoxypropionate |
| CAS No |
22409-91-2 |
| Synonyms |
3-Phenoxypropionic acid ethyl ester; ethyl 3-phenoxypropanoate |
| Molecular Formula |
C11H14O3 |
| Molecular Weight |
194.2271 |
| InChI |
InChI=1/C11H14O3/c1-2-13-11(12)8-9-14-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| Molecular Structure |
|
| Density |
1.061g/cm3 |
| Melting point |
22-24℃ |
| Boiling point |
287.6°C at 760 mmHg |
| Refractive index |
1.493 |
| Flash point |
116°C |
| Vapour Pressur |
0.00246mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Telephone |
+86-21-61066956/57/58??61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Contact |
Mr. Wei |
| Telephone |
+86-573-82813637;82813639 |
| Email |
sales@jlightchem.com |
| Address |
Dongtang slip, Jiaxing Industrial Park, Daqiao Town, Jiaxing, Zhejiang, China. |