ChemNet > CAS > 1135-23-5 3-(4-Hydroxymethyl)propionic acid
1135-23-5 3-(4-Hydroxymethyl)propionic acid
| ??? ????? |
3-(4-Hydroxymethyl)propionic acid |
| ??? ??????? |
3-(4-Hydroxymethyl)propionic acid; 3-(4-Hydroxy-3-methoxyphenyl)propionic acid; Hydroferulic acid; 3-(4-hydroxy-3-methoxyphenyl)propanoic acid; 3-(4-hydroxy-3-methoxyphenyl)propanoate |
| ????? ???????? |
C10H11O4 |
| ??? ??????? |
195.1925 |
| InChI |
InChI=1/C10H12O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2,4,6,11H,3,5H2,1H3,(H,12,13)/p-1 |
| ????? ?????? |
1135-23-5 |
| ????? ??????? ??????? |
214-489-5 |
| ?????? ??????? |
|
| ???? ??? |
89-90℃ |
| ???? ????? |
376.5°C at 760 mmHg |
| ???? ?????? |
151.1°C |
| ???? ???? |
2.45E-06mmHg at 25°C |
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|