ChemNet > CAS > 1135-23-5 3-(4-Hydroxymethyl)propionic acid
1135-23-5 3-(4-Hydroxymethyl)propionic acid
| Produkt-Name |
3-(4-Hydroxymethyl)propionic acid |
| Englischer Name |
3-(4-Hydroxymethyl)propionic acid; 3-(4-Hydroxy-3-methoxyphenyl)propionic acid; Hydroferulic acid; 3-(4-hydroxy-3-methoxyphenyl)propanoic acid; 3-(4-hydroxy-3-methoxyphenyl)propanoate |
| Molekulare Formel |
C10H11O4 |
| Molecular Weight |
195.1925 |
| InChI |
InChI=1/C10H12O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2,4,6,11H,3,5H2,1H3,(H,12,13)/p-1 |
| CAS Registry Number |
1135-23-5 |
| EINECS |
214-489-5 |
| Molecular Structure |
|
| Schmelzpunkt |
89-90℃ |
| Siedepunkt |
376.5°C at 760 mmHg |
| Flammpunkt |
151.1°C |
| Dampfdruck |
2.45E-06mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|